C19H20N2O3S — CID 163693434
1-(methylamino)-4-[2-(methyl-methylidene-oxo-λ6-sulfanyl)ethylamino]anthracene-9,10-dione (PubChem CID 163693434) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-(methylamino)-4-[2-(methyl-methylidene-oxo-λ6-sulfanyl)ethylamino]anthracene-9,10-dione.
| Compound Name | 1-(methylamino)-4-[2-(methyl-methylidene-oxo-λ6-sulfanyl)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 163693434 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-(methylamino)-4-[2-(methyl-methylidene-oxo-λ6-sulfanyl)ethylamino]anthracene-9,10-dione |
| SMILES | C=S(C)(=O)CCNc1ccc(NC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H20N2O3S/c1-20-14-8-9-15(21-10-11-25(2,3)24)17-16(14)18(22)12-6-4-5-7-13(12)19(17)23/h4-9,20-21H,2,10-11H2,1,3H3 |
| InChIKey | JUXWLQJUMYSUOX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|