C21H18F5IN6 — CID 163693646
2-amino-4-(1-cyanocyclopropyl)-N-[7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-6,7-dihydropyrazolo[5,4-c]pyridin-5-yl]benzenecarboximidoyl iodide (PubChem CID 163693646) has the molecular formula C21H18F5IN6 and a molecular weight of 576.31 g/mol. Its IUPAC name is 2-amino-4-(1-cyanocyclopropyl)-N-[7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-6,7-dihydropyrazolo[5,4-c]pyridin-5-yl]benzenecarboximidoyl iodide.
| Compound Name | 2-amino-4-(1-cyanocyclopropyl)-N-[7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-6,7-dihydropyrazolo[5,4-c]pyridin-5-yl]benzenecarboximidoyl iodide |
|---|---|
| PubChem CID | 163693646 |
| Molecular Formula | C21H18F5IN6 |
| Molecular Weight | 576.31 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | 2-amino-4-(1-cyanocyclopropyl)-N-[7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-6,7-dihydropyrazolo[5,4-c]pyridin-5-yl]benzenecarboximidoyl iodide |
| SMILES | CC1NC(N=C(I)c2ccc(C3(C#N)CC3)cc2N)=Cc2cnn(CC(F)(F)C(F)(F)F)c21 |
| InChI | InChI=1S/C21H18F5IN6/c1-11-17-12(8-30-33(17)10-20(22,23)21(24,25)26)6-16(31-11)32-18(27)14-3-2-13(7-15(14)29)19(9-28)4-5-19/h2-3,6-8,11,31H,4-5,10,29H2,1H3 |
| InChIKey | MGXFJTZBVHXPFM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|