C23H33NO3 — CID 163694097
2-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-propylacetamide (PubChem CID 163694097) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is 2-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-propylacetamide.
| Compound Name | 2-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 163694097 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 2-[(13S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CC1CC2C3CCc4cc(O)ccc4C3CC[C@]2(C)C1O |
| InChI | InChI=1S/C23H33NO3/c1-3-10-24-21(26)13-15-12-20-19-6-4-14-11-16(25)5-7-17(14)18(19)8-9-23(20,2)22(15)27/h5,7,11,15,18-20,22,25,27H,3-4,6,8-10,12-13H2,1-2H3,(H,24,26)/t15?,18?,19?,20?,22?,23-/m0/s1 |
| InChIKey | JVLMFYDSZZILNY-WECWEXGJSA-N |
| XLogP | 3.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |