C27H40N2O9 — CID 163694240
2-O-tert-butyl 5-O-ethyl 6,8-dioxo-2-azaspiro[3.5]nonane-2,5-dicarboxylate;tert-butyl 3-(2-oxopropylidene)azetidine-1-carboxylate (PubChem CID 163694240) has the molecular formula C27H40N2O9 and a molecular weight of 536.62 g/mol. Its IUPAC name is 2-O-tert-butyl 5-O-ethyl 6,8-dioxo-2-azaspiro[3.5]nonane-2,5-dicarboxylate;tert-butyl 3-(2-oxopropylidene)azetidine-1-carboxylate.
| Compound Name | 2-O-tert-butyl 5-O-ethyl 6,8-dioxo-2-azaspiro[3.5]nonane-2,5-dicarboxylate;tert-butyl 3-(2-oxopropylidene)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163694240 |
| Molecular Formula | C27H40N2O9 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-O-tert-butyl 5-O-ethyl 6,8-dioxo-2-azaspiro[3.5]nonane-2,5-dicarboxylate;tert-butyl 3-(2-oxopropylidene)azetidine-1-carboxylate |
| SMILES | CC(=O)C=C1CN(C(=O)OC(C)(C)C)C1.CCOC(=O)C1C(=O)CC(=O)CC12CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C16H23NO6.C11H17NO3/c1-5-22-13(20)12-11(19)6-10(18)7-16(12)8-17(9-16)14(21)23-15(2,3)4;1-8(13)5-9-6-12(7-9)10(14)15-11(2,3)4/h12H,5-9H2,1-4H3;5H,6-7H2,1-4H3 |
| InChIKey | JVOHTSWDTZFOAX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|