C29H44O5 — CID 163694808
(10R,13S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-11-(1-hydroxycyclooctyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 163694808) has the molecular formula C29H44O5 and a molecular weight of 472.67 g/mol. Its IUPAC name is (10R,13S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-11-(1-hydroxycyclooctyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-11-(1-hydroxycyclooctyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163694808 |
| Molecular Formula | C29H44O5 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | (10R,13S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-11-(1-hydroxycyclooctyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C2C(C2(O)CCCCCCC2)C[C@@]2(C)C1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C29H44O5/c1-26-14-10-20(31)16-19(26)8-9-21-22-11-15-29(34,24(32)18-30)27(22,2)17-23(25(21)26)28(33)12-6-4-3-5-7-13-28/h16,21-23,25,30,33-34H,3-15,17-18H2,1-2H3/t21?,22?,23?,25?,26-,27-,29-/m0/s1 |
| InChIKey | JWBCHCOFYGKHRZ-QSPCKATASA-N |
| XLogP | 4.51 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |