C18H32N4O2 — CID 163695016
1-[4-(diethylamino)piperidin-1-yl]-3-hydroxy-3-(1-propan-2-ylimidazol-2-yl)propan-1-one (PubChem CID 163695016) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[4-(diethylamino)piperidin-1-yl]-3-hydroxy-3-(1-propan-2-ylimidazol-2-yl)propan-1-one.
| Compound Name | 1-[4-(diethylamino)piperidin-1-yl]-3-hydroxy-3-(1-propan-2-ylimidazol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 163695016 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-[4-(diethylamino)piperidin-1-yl]-3-hydroxy-3-(1-propan-2-ylimidazol-2-yl)propan-1-one |
| SMILES | CCN(CC)C1CCN(C(=O)CC(O)c2nccn2C(C)C)CC1 |
| InChI | InChI=1S/C18H32N4O2/c1-5-20(6-2)15-7-10-21(11-8-15)17(24)13-16(23)18-19-9-12-22(18)14(3)4/h9,12,14-16,23H,5-8,10-11,13H2,1-4H3 |
| InChIKey | JWFJNBIFLLSFJL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |