C19H26NO3- — CID 163695489
[3-ethyl-5-methyl-2-(5,5,7,7-tetramethyl-4-oxo-1,6-dioxaspiro[2.4]heptan-2-yl)phenyl]-methylazanide (PubChem CID 163695489) has the molecular formula C19H26NO3- and a molecular weight of 316.42 g/mol. Its IUPAC name is [3-ethyl-5-methyl-2-(5,5,7,7-tetramethyl-4-oxo-1,6-dioxaspiro[2.4]heptan-2-yl)phenyl]-methylazanide.
| Compound Name | [3-ethyl-5-methyl-2-(5,5,7,7-tetramethyl-4-oxo-1,6-dioxaspiro[2.4]heptan-2-yl)phenyl]-methylazanide |
|---|---|
| PubChem CID | 163695489 |
| Molecular Formula | C19H26NO3- |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | [3-ethyl-5-methyl-2-(5,5,7,7-tetramethyl-4-oxo-1,6-dioxaspiro[2.4]heptan-2-yl)phenyl]-methylazanide |
| SMILES | CCc1cc(C)cc([N-]C)c1C1OC12C(=O)C(C)(C)OC2(C)C |
| InChI | InChI=1S/C19H26NO3/c1-8-12-9-11(2)10-13(20-7)14(12)15-19(22-15)16(21)17(3,4)23-18(19,5)6/h9-10,15H,8H2,1-7H3/q-1 |
| InChIKey | UGIDQTXXRSJCGY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|