C12H7BrCl2S — CID 163695952
1-(3-bromophenyl)sulfanyl-3,5-dichlorobenzene (PubChem CID 163695952) has the molecular formula C12H7BrCl2S and a molecular weight of 334.07 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfanyl-3,5-dichlorobenzene.
| Compound Name | 1-(3-bromophenyl)sulfanyl-3,5-dichlorobenzene |
|---|---|
| PubChem CID | 163695952 |
| Molecular Formula | C12H7BrCl2S |
| Molecular Weight | 334.07 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | 1-(3-bromophenyl)sulfanyl-3,5-dichlorobenzene |
| SMILES | Clc1cc(Cl)cc(Sc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C12H7BrCl2S/c13-8-2-1-3-11(4-8)16-12-6-9(14)5-10(15)7-12/h1-7H |
| InChIKey | JWYXEIKPOYGHEV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.07 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |