C11H13NO2 — CID 163696208
(2E,7Z)-2,4-dimethylazonine-4-carboxylic acid (PubChem CID 163696208) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (2E,7Z)-2,4-dimethylazonine-4-carboxylic acid.
| Compound Name | (2E,7Z)-2,4-dimethylazonine-4-carboxylic acid |
|---|---|
| PubChem CID | 163696208 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2E,7Z)-2,4-dimethylazonine-4-carboxylic acid |
| SMILES | CC1=C\C(C)(C(=O)O)C=C/C=C/C=N\1 |
| InChI | InChI=1S/C11H13NO2/c1-9-8-11(2,10(13)14)6-4-3-5-7-12-9/h3-8H,1-2H3,(H,13,14)/b5-3+,6-4?,9-8+,12-7- |
| InChIKey | JXEKYGKZWVEIEI-RPKFJDMASA-N |
| XLogP | 2.18 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |