About (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate
(1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate (PubChem CID 163696253) has the molecular formula C27H24FO4S+
and a molecular weight of 463.55 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate.
Molecular Properties
| Compound Name | (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate |
| PubChem CID | 163696253 |
| Molecular Formula | C27H24FO4S+ |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate |
| SMILES | CC1(OC(=O)COc2ccc3c(c2)c(=O)c2ccccc2[s+]3-c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C27H24FO4S/c1-27(14-4-5-15-27)32-25(29)17-31-19-10-13-24-22(16-19)26(30)21-6-2-3-7-23(21)33(24)20-11-8-18(28)9-12-20/h2-3,6-13,16H,4-5,14-15,17H2,1H3/q+1 |
| InChIKey | JXFOHCUFLOCVLG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate?
The IUPAC name of (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate (CID 163696253) is (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate.
What is the SMILES notation for (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate?
The canonical SMILES for (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate is CC1(OC(=O)COc2ccc3c(c2)c(=O)c2ccccc2[s+]3-c2ccc(F)cc2)CCCC1.
What is the InChIKey of (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate?
The InChIKey is JXFOHCUFLOCVLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24FO4S/c1-27(14-4-5-15-27)32-25(29)17-31-19-10-13-24-22(16-19)26(30)21-6-2-3-7-23(21)33(24)20-11-8-18(28)9-12-20/h2-3,6-13,16H,4-5,14-15,17H2,1H3/q+1.
What are the key properties of (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate?
(1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate has a molecular weight of 463.55 g/mol, XLogP of 6.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopentyl) 2-[10-(4-fluorophenyl)-9-oxothioxanthen-10-ium-2-yl]oxyacetate is sourced from PubChem (CID 163696253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).