C18H25F3N2 — CID 163696399
(2R)-2-[(2Z,4Z)-6-methyl-2-pyrrolidin-2-ylhepta-2,4-dien-3-yl]-3-(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 163696399) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is (2R)-2-[(2Z,4Z)-6-methyl-2-pyrrolidin-2-ylhepta-2,4-dien-3-yl]-3-(trifluoromethyl)-1,2-dihydropyridine.
| Compound Name | (2R)-2-[(2Z,4Z)-6-methyl-2-pyrrolidin-2-ylhepta-2,4-dien-3-yl]-3-(trifluoromethyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 163696399 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2R)-2-[(2Z,4Z)-6-methyl-2-pyrrolidin-2-ylhepta-2,4-dien-3-yl]-3-(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | C/C(=C(\C=C/C(C)C)[C@H]1NC=CC=C1C(F)(F)F)C1CCCN1 |
| InChI | InChI=1S/C18H25F3N2/c1-12(2)8-9-14(13(3)16-7-5-10-22-16)17-15(18(19,20)21)6-4-11-23-17/h4,6,8-9,11-12,16-17,22-23H,5,7,10H2,1-3H3/b9-8-,14-13-/t16?,17-/m1/s1 |
| InChIKey | JXINDQXQELYCGB-KJMXWNDTSA-N |
| XLogP | 4.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|