C11H18F3N — CID 163696649
(4Z)-7,7,7-trifluoro-N,N,2,6-tetramethylhepta-1,4-dien-3-amine (PubChem CID 163696649) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is (4Z)-7,7,7-trifluoro-N,N,2,6-tetramethylhepta-1,4-dien-3-amine.
| Compound Name | (4Z)-7,7,7-trifluoro-N,N,2,6-tetramethylhepta-1,4-dien-3-amine |
|---|---|
| PubChem CID | 163696649 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (4Z)-7,7,7-trifluoro-N,N,2,6-tetramethylhepta-1,4-dien-3-amine |
| SMILES | C=C(C)C(/C=C\C(C)C(F)(F)F)N(C)C |
| InChI | InChI=1S/C11H18F3N/c1-8(2)10(15(4)5)7-6-9(3)11(12,13)14/h6-7,9-10H,1H2,2-5H3/b7-6- |
| InChIKey | JXNLOPUSODPXGH-SREVYHEPSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|