C30H41NO4 — CID 163697010
(4-benzoylphenyl) 2,4,4,7,7-pentamethyl-5-(propan-2-ylcarbamoyl)octanoate (PubChem CID 163697010) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is (4-benzoylphenyl) 2,4,4,7,7-pentamethyl-5-(propan-2-ylcarbamoyl)octanoate.
| Compound Name | (4-benzoylphenyl) 2,4,4,7,7-pentamethyl-5-(propan-2-ylcarbamoyl)octanoate |
|---|---|
| PubChem CID | 163697010 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (4-benzoylphenyl) 2,4,4,7,7-pentamethyl-5-(propan-2-ylcarbamoyl)octanoate |
| SMILES | CC(C)NC(=O)C(CC(C)(C)C)C(C)(C)CC(C)C(=O)Oc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H41NO4/c1-20(2)31-27(33)25(19-29(4,5)6)30(7,8)18-21(3)28(34)35-24-16-14-23(15-17-24)26(32)22-12-10-9-11-13-22/h9-17,20-21,25H,18-19H2,1-8H3,(H,31,33) |
| InChIKey | JXTZLOHNURUHLU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|