C14H23IN3O2+ — CID 163697140
N-(3,3-diethyl-1,1,2-trimethylaziridin-1-ium-2-yl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide (PubChem CID 163697140) has the molecular formula C14H23IN3O2+ and a molecular weight of 392.26 g/mol. Its IUPAC name is N-(3,3-diethyl-1,1,2-trimethylaziridin-1-ium-2-yl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3,3-diethyl-1,1,2-trimethylaziridin-1-ium-2-yl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 163697140 |
| Molecular Formula | C14H23IN3O2+ |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-(3,3-diethyl-1,1,2-trimethylaziridin-1-ium-2-yl)-5-(iodomethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCC1(CC)C(C)(NC(=O)c2cc(CI)on2)[N+]1(C)C |
| InChI | InChI=1S/C14H22IN3O2/c1-6-14(7-2)13(3,18(14,4)5)16-12(19)11-8-10(9-15)20-17-11/h8H,6-7,9H2,1-5H3/p+1 |
| InChIKey | VFCVEDJNHUFSOY-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|