C28H12Br2F12 — CID 163697559
1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5-(3,5-dibromophenyl)benzene (PubChem CID 163697559) has the molecular formula C28H12Br2F12 and a molecular weight of 736.19 g/mol. Its IUPAC name is 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5-(3,5-dibromophenyl)benzene.
| Compound Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5-(3,5-dibromophenyl)benzene |
|---|---|
| PubChem CID | 163697559 |
| Molecular Formula | C28H12Br2F12 |
| Molecular Weight | 736.19 g/mol |
| Exact Mass | 733.91 |
| IUPAC Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-5-(3,5-dibromophenyl)benzene |
| SMILES | FC(F)(F)c1cc(-c2cc(-c3cc(Br)cc(Br)c3)cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H12Br2F12/c29-23-8-18(9-24(30)12-23)15-2-13(16-4-19(25(31,32)33)10-20(5-16)26(34,35)36)1-14(3-15)17-6-21(27(37,38)39)11-22(7-17)28(40,41)42/h1-12H |
| InChIKey | JYEXFZALJAGKDV-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.19 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |