C21H43N3 — CID 163697862
6-[(2R)-but-3-en-2-yl]-3-butyl-N-(3,4-dimethylpentan-2-yl)-2,2-dimethylpiperazin-1-amine (PubChem CID 163697862) has the molecular formula C21H43N3 and a molecular weight of 337.60 g/mol. Its IUPAC name is 6-[(2R)-but-3-en-2-yl]-3-butyl-N-(3,4-dimethylpentan-2-yl)-2,2-dimethylpiperazin-1-amine.
| Compound Name | 6-[(2R)-but-3-en-2-yl]-3-butyl-N-(3,4-dimethylpentan-2-yl)-2,2-dimethylpiperazin-1-amine |
|---|---|
| PubChem CID | 163697862 |
| Molecular Formula | C21H43N3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.35 |
| IUPAC Name | 6-[(2R)-but-3-en-2-yl]-3-butyl-N-(3,4-dimethylpentan-2-yl)-2,2-dimethylpiperazin-1-amine |
| SMILES | C=C[C@@H](C)C1CNC(CCCC)C(C)(C)N1NC(C)C(C)C(C)C |
| InChI | InChI=1S/C21H43N3/c1-10-12-13-20-21(8,9)24(19(14-22-20)16(5)11-2)23-18(7)17(6)15(3)4/h11,15-20,22-23H,2,10,12-14H2,1,3-9H3/t16-,17?,18?,19?,20?/m1/s1 |
| InChIKey | JYLJUXPEIJKVRH-PISSXIKFSA-N |
| XLogP | 4.60 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|