C12H9BrN2O2S2 — CID 163698061
5-bromo-1-(4-methylphenyl)sulfonylthieno[3,2-d]pyrazole (PubChem CID 163698061) has the molecular formula C12H9BrN2O2S2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 5-bromo-1-(4-methylphenyl)sulfonylthieno[3,2-d]pyrazole.
| Compound Name | 5-bromo-1-(4-methylphenyl)sulfonylthieno[3,2-d]pyrazole |
|---|---|
| PubChem CID | 163698061 |
| Molecular Formula | C12H9BrN2O2S2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 5-bromo-1-(4-methylphenyl)sulfonylthieno[3,2-d]pyrazole |
| SMILES | Cc1ccc(S(=O)(=O)n2ncc3cc(Br)sc32)cc1 |
| InChI | InChI=1S/C12H9BrN2O2S2/c1-8-2-4-10(5-3-8)19(16,17)15-12-9(7-14-15)6-11(13)18-12/h2-7H,1H3 |
| InChIKey | JYOZTNBQNUSBDF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |