About N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide
N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide (PubChem CID 163698443) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide |
| PubChem CID | 163698443 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(CO)(CCO)CCO |
| InChI | InChI=1S/C11H23NO4/c1-9(2)7-10(16)12-11(8-15,3-5-13)4-6-14/h9,13-15H,3-8H2,1-2H3,(H,12,16) |
| InChIKey | JYWZXGNURJLAFR-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide?
The IUPAC name of N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide (CID 163698443) is N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide.
What is the SMILES notation for N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide?
The canonical SMILES for N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide is CC(C)CC(=O)NC(CO)(CCO)CCO.
What is the InChIKey of N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide?
The InChIKey is JYWZXGNURJLAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4/c1-9(2)7-10(16)12-11(8-15,3-5-13)4-6-14/h9,13-15H,3-8H2,1-2H3,(H,12,16).
What are the key properties of N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide?
N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide has a molecular weight of 233.31 g/mol, XLogP of -0.36, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,5-dihydroxy-3-(hydroxymethyl)pentan-3-yl]-3-methylbutanamide is sourced from PubChem (CID 163698443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).