C26H22N6O2 — CID 163698802
3-[(4-amino-3-but-1-ynylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-(2-hydroxyphenyl)-8-methylisoquinolin-1-one (PubChem CID 163698802) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-[(4-amino-3-but-1-ynylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-(2-hydroxyphenyl)-8-methylisoquinolin-1-one.
| Compound Name | 3-[(4-amino-3-but-1-ynylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-(2-hydroxyphenyl)-8-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 163698802 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[(4-amino-3-but-1-ynylpyrazolo[3,4-d]pyrimidin-1-yl)methyl]-2-(2-hydroxyphenyl)-8-methylisoquinolin-1-one |
| SMILES | CCC#Cc1nn(Cc2cc3cccc(C)c3c(=O)n2-c2ccccc2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C26H22N6O2/c1-3-4-10-19-23-24(27)28-15-29-25(23)31(30-19)14-18-13-17-9-7-8-16(2)22(17)26(34)32(18)20-11-5-6-12-21(20)33/h5-9,11-13,15,33H,3,14H2,1-2H3,(H2,27,28,29) |
| InChIKey | JZEBZVQEGMULMN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|