C15H18N2 — CID 163699699
9,10-dimethyl-1,11-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,5,7,12-tetraene (PubChem CID 163699699) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 9,10-dimethyl-1,11-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,5,7,12-tetraene.
| Compound Name | 9,10-dimethyl-1,11-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,5,7,12-tetraene |
|---|---|
| PubChem CID | 163699699 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 9,10-dimethyl-1,11-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-2,5,7,12-tetraene |
| SMILES | CC1C2=CC=CC3C=CN4C=CN(C1C)C4C23 |
| InChI | InChI=1S/C15H18N2/c1-10-11(2)17-9-8-16-7-6-12-4-3-5-13(10)14(12)15(16)17/h3-12,14-15H,1-2H3 |
| InChIKey | JZXUWXPWKYLJFH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |