About 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine
4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine (PubChem CID 163700291) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 163700291 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine |
| SMILES | COC1=CC(N(C)CCN(C)C)C(N=O)C=C1N |
| InChI | InChI=1S/C12H22N4O2/c1-15(2)5-6-16(3)11-8-12(18-4)9(13)7-10(11)14-17/h7-8,10-11H,5-6,13H2,1-4H3 |
| InChIKey | KAKBKLXUTRCRRM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine (CID 163700291) is 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine is COC1=CC(N(C)CCN(C)C)C(N=O)C=C1N.
What is the InChIKey of 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine?
The InChIKey is KAKBKLXUTRCRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2/c1-15(2)5-6-16(3)11-8-12(18-4)9(13)7-10(11)14-17/h7-8,10-11H,5-6,13H2,1-4H3.
What are the key properties of 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine?
4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine has a molecular weight of 254.33 g/mol, XLogP of 0.37, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[2-(dimethylamino)ethyl]-6-methoxy-4-N-methyl-3-nitrosocyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 163700291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).