N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride

C6H11FN4 — CID 163700461

IUPACN-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride
SMILES[H]/N=C(N)/C(N)=C(C)\N=C(/C)F
InChIInChI=1S/C6H11FN4/c1-3(11-4(2)7)5(8)6(9)10/h8H2,1-2H3,(H3,9,10)/b5-3+,11-4+
InChIKeyKANIXRIKIYWPNR-NIDLAPIMSA-N
MW158.18 g/mol
LogP0.50
Rot. Bonds2

About N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride

N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride (PubChem CID 163700461) has the molecular formula C6H11FN4 and a molecular weight of 158.18 g/mol. Its IUPAC name is N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride.

Molecular Properties

Compound NameN-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride
PubChem CID163700461
Molecular FormulaC6H11FN4
Molecular Weight158.18 g/mol
Exact Mass158.10
IUPAC NameN-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride
SMILES[H]/N=C(N)/C(N)=C(C)\N=C(/C)F
InChIInChI=1S/C6H11FN4/c1-3(11-4(2)7)5(8)6(9)10/h8H2,1-2H3,(H3,9,10)/b5-3+,11-4+
InChIKeyKANIXRIKIYWPNR-NIDLAPIMSA-N
XLogP0.50
TPSA88.25 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.18
LogP ≤ 50.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride?
The IUPAC name of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride (CID 163700461) is N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride.
What is the SMILES notation for N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride?
The canonical SMILES for N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride is [H]/N=C(N)/C(N)=C(C)\N=C(/C)F.
What is the InChIKey of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride?
The InChIKey is KANIXRIKIYWPNR-NIDLAPIMSA-N. The full InChI is InChI=1S/C6H11FN4/c1-3(11-4(2)7)5(8)6(9)10/h8H2,1-2H3,(H3,9,10)/b5-3+,11-4+.
What are the key properties of N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride?
N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride has a molecular weight of 158.18 g/mol, XLogP of 0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3,4-diamino-4-iminobut-2-en-2-yl]ethanimidoyl fluoride is sourced from PubChem (CID 163700461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).