C42H39NSSi2 — CID 163701262
[9-[4-(4-dibenzothiophen-1-ylphenyl)phenyl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane (PubChem CID 163701262) has the molecular formula C42H39NSSi2 and a molecular weight of 646.02 g/mol. Its IUPAC name is [9-[4-(4-dibenzothiophen-1-ylphenyl)phenyl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane.
| Compound Name | [9-[4-(4-dibenzothiophen-1-ylphenyl)phenyl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 163701262 |
| Molecular Formula | C42H39NSSi2 |
| Molecular Weight | 646.02 g/mol |
| Exact Mass | 645.23 |
| IUPAC Name | [9-[4-(4-dibenzothiophen-1-ylphenyl)phenyl]-6-trimethylsilylcarbazol-3-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)c1cc([Si](C)(C)C)ccc1n2-c1ccc(-c2ccc(-c3cccc4sc5ccccc5c34)cc2)cc1 |
| InChI | InChI=1S/C42H39NSSi2/c1-45(2,3)32-22-24-38-36(26-32)37-27-33(46(4,5)6)23-25-39(37)43(38)31-20-18-29(19-21-31)28-14-16-30(17-15-28)34-11-9-13-41-42(34)35-10-7-8-12-40(35)44-41/h7-27H,1-6H3 |
| InChIKey | RPSMWGKMUOUHAA-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.02 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|