About 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium
6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium (PubChem CID 163701804) has the molecular formula C11H12FIN+
and a molecular weight of 304.13 g/mol. Its IUPAC name is 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium.
Molecular Properties
| Compound Name | 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium |
| PubChem CID | 163701804 |
| Molecular Formula | C11H12FIN+ |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium |
| SMILES | CC1=[N+](C)C2CC(I)=C(F)C=C2C=C1 |
| InChI | InChI=1S/C11H12FIN/c1-7-3-4-8-5-9(12)10(13)6-11(8)14(7)2/h3-5,11H,6H2,1-2H3/q+1 |
| InChIKey | KBQUZBSMHHWFGH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium?
The IUPAC name of 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium (CID 163701804) is 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium.
What is the SMILES notation for 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium?
The canonical SMILES for 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium is CC1=[N+](C)C2CC(I)=C(F)C=C2C=C1.
What is the InChIKey of 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium?
The InChIKey is KBQUZBSMHHWFGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FIN/c1-7-3-4-8-5-9(12)10(13)6-11(8)14(7)2/h3-5,11H,6H2,1-2H3/q+1.
What are the key properties of 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium?
6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium has a molecular weight of 304.13 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-7-iodo-1,2-dimethyl-8,8a-dihydroquinolin-1-ium is sourced from PubChem (CID 163701804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).