C14H12ClNO5 — CID 163701854
methyl 6-(5-chloro-2-nitrophenoxy)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 163701854) has the molecular formula C14H12ClNO5 and a molecular weight of 309.70 g/mol. Its IUPAC name is methyl 6-(5-chloro-2-nitrophenoxy)cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 6-(5-chloro-2-nitrophenoxy)cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 163701854 |
| Molecular Formula | C14H12ClNO5 |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | methyl 6-(5-chloro-2-nitrophenoxy)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCCC=C1Oc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12ClNO5/c1-20-14(17)10-4-2-3-5-12(10)21-13-8-9(15)6-7-11(13)16(18)19/h4-8H,2-3H2,1H3 |
| InChIKey | KBSASDGEAMQDIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|