C13H18FN — CID 163702230
8-fluoro-10-methyl-1,4,4a,6,7,8,9,10a-octahydropyrido[1,2-a]indole (PubChem CID 163702230) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 8-fluoro-10-methyl-1,4,4a,6,7,8,9,10a-octahydropyrido[1,2-a]indole.
| Compound Name | 8-fluoro-10-methyl-1,4,4a,6,7,8,9,10a-octahydropyrido[1,2-a]indole |
|---|---|
| PubChem CID | 163702230 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 8-fluoro-10-methyl-1,4,4a,6,7,8,9,10a-octahydropyrido[1,2-a]indole |
| SMILES | CC1=C2CC(F)CCN2C2CC=CCC12 |
| InChI | InChI=1S/C13H18FN/c1-9-11-4-2-3-5-12(11)15-7-6-10(14)8-13(9)15/h2-3,10-12H,4-8H2,1H3 |
| InChIKey | KCABAMMTFNFIOQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|