C42H42O6 — CID 163702231
9,9-bis[[4-(1-hydroxycyclohexanecarbonyl)phenyl]methyl]fluorene-2-carboxylic acid (PubChem CID 163702231) has the molecular formula C42H42O6 and a molecular weight of 642.79 g/mol. Its IUPAC name is 9,9-bis[[4-(1-hydroxycyclohexanecarbonyl)phenyl]methyl]fluorene-2-carboxylic acid.
| Compound Name | 9,9-bis[[4-(1-hydroxycyclohexanecarbonyl)phenyl]methyl]fluorene-2-carboxylic acid |
|---|---|
| PubChem CID | 163702231 |
| Molecular Formula | C42H42O6 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 9,9-bis[[4-(1-hydroxycyclohexanecarbonyl)phenyl]methyl]fluorene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(Cc1ccc(C(=O)C3(O)CCCCC3)cc1)(Cc1ccc(C(=O)C3(O)CCCCC3)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C42H42O6/c43-37(41(47)21-5-1-6-22-41)30-15-11-28(12-16-30)26-40(27-29-13-17-31(18-14-29)38(44)42(48)23-7-2-8-24-42)35-10-4-3-9-33(35)34-20-19-32(39(45)46)25-36(34)40/h3-4,9-20,25,47-48H,1-2,5-8,21-24,26-27H2,(H,45,46) |
| InChIKey | KCABDDYALHVVOB-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |