C9H14N2O7 — CID 163702253
(6-aminooxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 2-aminoacetate (PubChem CID 163702253) has the molecular formula C9H14N2O7 and a molecular weight of 262.22 g/mol. Its IUPAC name is (6-aminooxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 2-aminoacetate.
| Compound Name | (6-aminooxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 2-aminoacetate |
|---|---|
| PubChem CID | 163702253 |
| Molecular Formula | C9H14N2O7 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (6-aminooxycarbonyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 2-aminoacetate |
| SMILES | NCC(=O)OC1COC2C(OC(=O)ON)COC12 |
| InChI | InChI=1S/C9H14N2O7/c10-1-6(12)16-4-2-14-8-5(3-15-7(4)8)17-9(13)18-11/h4-5,7-8H,1-3,10-11H2 |
| InChIKey | KCAHBZDUQJLTMW-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|