C16H27FN2 — CID 163702676
(1Z,3E)-5-N-[(Z)-3-fluoropent-2-en-2-yl]-1-N,1-N,5-N,3,4-pentamethylhexa-1,3,5-triene-1,5-diamine (PubChem CID 163702676) has the molecular formula C16H27FN2 and a molecular weight of 266.40 g/mol. Its IUPAC name is (1Z,3E)-5-N-[(Z)-3-fluoropent-2-en-2-yl]-1-N,1-N,5-N,3,4-pentamethylhexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3E)-5-N-[(Z)-3-fluoropent-2-en-2-yl]-1-N,1-N,5-N,3,4-pentamethylhexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 163702676 |
| Molecular Formula | C16H27FN2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (1Z,3E)-5-N-[(Z)-3-fluoropent-2-en-2-yl]-1-N,1-N,5-N,3,4-pentamethylhexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(/C(C)=C(C)/C=C\N(C)C)N(C)/C(C)=C(\F)CC |
| InChI | InChI=1S/C16H27FN2/c1-9-16(17)15(5)19(8)14(4)13(3)12(2)10-11-18(6)7/h10-11H,4,9H2,1-3,5-8H3/b11-10-,13-12+,16-15- |
| InChIKey | KCKGGTPUIBJRFK-JZLDRFSISA-N |
| XLogP | 4.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|