C5H12N4 — CID 163702806
(1Z,3Z)-4-N-methylbuta-1,3-diene-1,2,3,4-tetramine (PubChem CID 163702806) has the molecular formula C5H12N4 and a molecular weight of 128.18 g/mol. Its IUPAC name is (1Z,3Z)-4-N-methylbuta-1,3-diene-1,2,3,4-tetramine.
| Compound Name | (1Z,3Z)-4-N-methylbuta-1,3-diene-1,2,3,4-tetramine |
|---|---|
| PubChem CID | 163702806 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | (1Z,3Z)-4-N-methylbuta-1,3-diene-1,2,3,4-tetramine |
| SMILES | CN/C=C(N)/C(N)=C/N |
| InChI | InChI=1S/C5H12N4/c1-9-3-5(8)4(7)2-6/h2-3,9H,6-8H2,1H3/b4-2-,5-3- |
| InChIKey | KCMSSJWGABPSRW-JVLMNHKTSA-N |
| XLogP | -1.24 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|