C36H32N6 — CID 163703385
3,8-bis(3,5-dimethylpyrazol-1-yl)-5,10-diphenyl-4b,9b-dihydroindolo[3,2-b]indole (PubChem CID 163703385) has the molecular formula C36H32N6 and a molecular weight of 548.69 g/mol. Its IUPAC name is 3,8-bis(3,5-dimethylpyrazol-1-yl)-5,10-diphenyl-4b,9b-dihydroindolo[3,2-b]indole.
| Compound Name | 3,8-bis(3,5-dimethylpyrazol-1-yl)-5,10-diphenyl-4b,9b-dihydroindolo[3,2-b]indole |
|---|---|
| PubChem CID | 163703385 |
| Molecular Formula | C36H32N6 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 3,8-bis(3,5-dimethylpyrazol-1-yl)-5,10-diphenyl-4b,9b-dihydroindolo[3,2-b]indole |
| SMILES | Cc1cc(C)n(-c2ccc3c(c2)C2C(c4cc(-n5nc(C)cc5C)ccc4N2c2ccccc2)N3c2ccccc2)n1 |
| InChI | InChI=1S/C36H32N6/c1-23-19-25(3)41(37-23)29-15-17-33-31(21-29)35-36(39(33)27-11-7-5-8-12-27)32-22-30(42-26(4)20-24(2)38-42)16-18-34(32)40(35)28-13-9-6-10-14-28/h5-22,35-36H,1-4H3 |
| InChIKey | KCYXYTWBTZYBMD-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |