C37H27N5O4S — CID 163703444
(5E)-5-[[5-(N-[5-[(3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl)methyl]naphthalen-1-yl]anilino)thiophen-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 163703444) has the molecular formula C37H27N5O4S and a molecular weight of 637.72 g/mol. Its IUPAC name is (5E)-5-[[5-(N-[5-[(3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl)methyl]naphthalen-1-yl]anilino)thiophen-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[5-(N-[5-[(3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl)methyl]naphthalen-1-yl]anilino)thiophen-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163703444 |
| Molecular Formula | C37H27N5O4S |
| Molecular Weight | 637.72 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | (5E)-5-[[5-(N-[5-[(3-cyano-2-hydroxy-4-methyl-6-oxo-1-pyridinyl)methyl]naphthalen-1-yl]anilino)thiophen-2-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=C/c1ccc(N(c2ccccc2)c2cccc3c(Cn4c(O)c(C#N)c(C)cc4=O)cccc23)s1 |
| InChI | InChI=1S/C37H27N5O4S/c1-22-17-33(43)41(37(46)30(22)19-38)21-24-9-7-13-28-27(24)12-8-14-32(28)42(25-10-5-4-6-11-25)34-16-15-26(47-34)18-29-23(2)31(20-39)36(45)40(3)35(29)44/h4-18,46H,21H2,1-3H3/b29-18+ |
| InChIKey | XKEQKOHOJALPJG-RDRPBHBLSA-N |
| XLogP | 6.69 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.72 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|