C30H46N6O — CID 163703708
1-[8-amino-2-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methylimino]-5-methyl-3,4-dihydro-1H-azocin-6-yl]piperidin-3-one (PubChem CID 163703708) has the molecular formula C30H46N6O and a molecular weight of 506.74 g/mol. Its IUPAC name is 1-[8-amino-2-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methylimino]-5-methyl-3,4-dihydro-1H-azocin-6-yl]piperidin-3-one.
| Compound Name | 1-[8-amino-2-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methylimino]-5-methyl-3,4-dihydro-1H-azocin-6-yl]piperidin-3-one |
|---|---|
| PubChem CID | 163703708 |
| Molecular Formula | C30H46N6O |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.37 |
| IUPAC Name | 1-[8-amino-2-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methylimino]-5-methyl-3,4-dihydro-1H-azocin-6-yl]piperidin-3-one |
| SMILES | CC1=C(N2CCCC(=O)C2)C=C(N)N/C(=N/Cc2ccc(CNCCCNC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C30H46N6O/c1-23-10-15-30(35-29(31)19-28(23)36-18-5-9-27(37)22-36)34-21-25-13-11-24(12-14-25)20-32-16-6-17-33-26-7-3-2-4-8-26/h11-14,19,26,32-33H,2-10,15-18,20-22,31H2,1H3,(H,34,35) |
| InChIKey | KDFKOMIJALRBCE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|