About benzylbenzene;uranium;dihydrate
benzylbenzene;uranium;dihydrate (PubChem CID 163704034) has the molecular formula C13H15O2U-
and a molecular weight of 441.29 g/mol. Its IUPAC name is benzylbenzene;uranium;dihydrate.
Molecular Properties
| Compound Name | benzylbenzene;uranium;dihydrate |
| PubChem CID | 163704034 |
| Molecular Formula | C13H15O2U- |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | benzylbenzene;uranium;dihydrate |
| SMILES | O.O.[U].[c-]1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11.2H2O.U/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;;/h1,3-10H,11H2;2*1H2;/q-1;;; |
| InChIKey | WKPSVSUSVFNSFG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;uranium;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;uranium;dihydrate?
The IUPAC name of benzylbenzene;uranium;dihydrate (CID 163704034) is benzylbenzene;uranium;dihydrate.
What is the SMILES notation for benzylbenzene;uranium;dihydrate?
The canonical SMILES for benzylbenzene;uranium;dihydrate is O.O.[U].[c-]1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;uranium;dihydrate?
The InChIKey is WKPSVSUSVFNSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11.2H2O.U/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;;/h1,3-10H,11H2;2*1H2;/q-1;;;.
What are the key properties of benzylbenzene;uranium;dihydrate?
benzylbenzene;uranium;dihydrate has a molecular weight of 441.29 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;uranium;dihydrate is sourced from PubChem (CID 163704034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).