C26H30ClN5O4 — CID 163704144
3-chloro-4-[[5-methyl-6-[(3,3,10,12-tetramethyl-6-oxo-5,11-dioxa-7-azatricyclo[7.3.1.02,7]tridecan-13-yl)oxy]pyrimidin-4-yl]amino]benzonitrile (PubChem CID 163704144) has the molecular formula C26H30ClN5O4 and a molecular weight of 512.01 g/mol. Its IUPAC name is 3-chloro-4-[[5-methyl-6-[(3,3,10,12-tetramethyl-6-oxo-5,11-dioxa-7-azatricyclo[7.3.1.02,7]tridecan-13-yl)oxy]pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-chloro-4-[[5-methyl-6-[(3,3,10,12-tetramethyl-6-oxo-5,11-dioxa-7-azatricyclo[7.3.1.02,7]tridecan-13-yl)oxy]pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 163704144 |
| Molecular Formula | C26H30ClN5O4 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 3-chloro-4-[[5-methyl-6-[(3,3,10,12-tetramethyl-6-oxo-5,11-dioxa-7-azatricyclo[7.3.1.02,7]tridecan-13-yl)oxy]pyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1c(Nc2ccc(C#N)cc2Cl)ncnc1OC1C2CN3C(=O)OCC(C)(C)C3C1C(C)OC2C |
| InChI | InChI=1S/C26H30ClN5O4/c1-13-23(31-19-7-6-16(9-28)8-18(19)27)29-12-30-24(13)36-21-17-10-32-22(20(21)15(3)35-14(17)2)26(4,5)11-34-25(32)33/h6-8,12,14-15,17,20-22H,10-11H2,1-5H3,(H,29,30,31) |
| InChIKey | KDOREXSZZHWCDW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |