About [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol
[2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol (PubChem CID 163704234) has the molecular formula C13H8Br2OS3
and a molecular weight of 436.22 g/mol. Its IUPAC name is [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol.
Molecular Properties
| Compound Name | [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol |
| PubChem CID | 163704234 |
| Molecular Formula | C13H8Br2OS3 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 433.81 |
| IUPAC Name | [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol |
| SMILES | OCc1cc(-c2ccc(Br)s2)sc1-c1ccc(Br)s1 |
| InChI | InChI=1S/C13H8Br2OS3/c14-11-3-1-8(17-11)10-5-7(6-16)13(19-10)9-2-4-12(15)18-9/h1-5,16H,6H2 |
| InChIKey | KDQHOOXCKXEFFM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol?
The IUPAC name of [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol (CID 163704234) is [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol.
What is the SMILES notation for [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol?
The canonical SMILES for [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol is OCc1cc(-c2ccc(Br)s2)sc1-c1ccc(Br)s1.
What is the InChIKey of [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol?
The InChIKey is KDQHOOXCKXEFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2OS3/c14-11-3-1-8(17-11)10-5-7(6-16)13(19-10)9-2-4-12(15)18-9/h1-5,16H,6H2.
What are the key properties of [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol?
[2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol has a molecular weight of 436.22 g/mol, XLogP of 6.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-bis(5-bromothiophen-2-yl)thiophen-3-yl]methanol is sourced from PubChem (CID 163704234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).