About CID 163704459
CID 163704459 (PubChem CID 163704459) has the molecular formula C30H44BBrN13O2SSi2
and a molecular weight of 797.73 g/mol.
Molecular Properties
| Compound Name | CID 163704459 |
| PubChem CID | 163704459 |
| Molecular Formula | C30H44BBrN13O2SSi2 |
| Molecular Weight | 797.73 g/mol |
| Exact Mass | 796.23 |
| IUPAC Name | — |
| SMILES | Cc1nnnn1-c1ccc2c(Br)cn(COCC[Si](C)(C)C)c2n1.Cc1nnnn1-c1ccc2ccn(COCC[Si](C)(C)C)c2n1.[B]=NS |
| InChI | InChI=1S/C15H21BrN6OSi.C15H22N6OSi.BHNS/c1-11-18-19-20-22(11)14-6-5-12-13(16)9-21(15(12)17-14)10-23-7-8-24(2,3)4;1-12-17-18-19-21(12)14-6-5-13-7-8-20(15(13)16-14)11-22-9-10-23(2,3)4;1-2-3/h5-6,9H,7-8,10H2,1-4H3;5-8H,9-11H2,1-4H3;3H |
| InChIKey | WZKYQVIRNMDCER-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 797.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 163704459 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163704459?
The IUPAC name of CID 163704459 (CID 163704459) is not available.
What is the SMILES notation for CID 163704459?
The canonical SMILES for CID 163704459 is Cc1nnnn1-c1ccc2c(Br)cn(COCC[Si](C)(C)C)c2n1.Cc1nnnn1-c1ccc2ccn(COCC[Si](C)(C)C)c2n1.[B]=NS.
What is the InChIKey of CID 163704459?
The InChIKey is WZKYQVIRNMDCER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrN6OSi.C15H22N6OSi.BHNS/c1-11-18-19-20-22(11)14-6-5-12-13(16)9-21(15(12)17-14)10-23-7-8-24(2,3)4;1-12-17-18-19-21(12)14-6-5-13-7-8-20(15(13)16-14)11-22-9-10-23(2,3)4;1-2-3/h5-6,9H,7-8,10H2,1-4H3;5-8H,9-11H2,1-4H3;3H.
What are the key properties of CID 163704459?
CID 163704459 has a molecular weight of 797.73 g/mol, XLogP of 6.21, 12 rotatable bonds, 1 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163704459 is sourced from PubChem (CID 163704459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).