About methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate
methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate (PubChem CID 163705317) has the molecular formula C19H17FN2O2
and a molecular weight of 324.36 g/mol. Its IUPAC name is methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate |
| PubChem CID | 163705317 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cncc(C)c2)cnc1C1C=CC=CC1F |
| InChI | InChI=1S/C19H17FN2O2/c1-12-7-13(10-21-9-12)14-8-16(19(23)24-2)18(22-11-14)15-5-3-4-6-17(15)20/h3-11,15,17H,1-2H3 |
| InChIKey | KEOFCLCHRQJWSY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate?
The IUPAC name of methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate (CID 163705317) is methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate?
The canonical SMILES for methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate is COC(=O)c1cc(-c2cncc(C)c2)cnc1C1C=CC=CC1F.
What is the InChIKey of methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate?
The InChIKey is KEOFCLCHRQJWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O2/c1-12-7-13(10-21-9-12)14-8-16(19(23)24-2)18(22-11-14)15-5-3-4-6-17(15)20/h3-11,15,17H,1-2H3.
What are the key properties of methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate?
methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate has a molecular weight of 324.36 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-fluorocyclohexa-2,4-dien-1-yl)-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate is sourced from PubChem (CID 163705317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).