C13H12ClFN2O2S — CID 163706048
3-(4-chloro-2-fluoro-5-sulfanylphenyl)-1,5,6-trimethylpyrimidine-2,4-dione (PubChem CID 163706048) has the molecular formula C13H12ClFN2O2S and a molecular weight of 314.77 g/mol. Its IUPAC name is 3-(4-chloro-2-fluoro-5-sulfanylphenyl)-1,5,6-trimethylpyrimidine-2,4-dione.
| Compound Name | 3-(4-chloro-2-fluoro-5-sulfanylphenyl)-1,5,6-trimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163706048 |
| Molecular Formula | C13H12ClFN2O2S |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-(4-chloro-2-fluoro-5-sulfanylphenyl)-1,5,6-trimethylpyrimidine-2,4-dione |
| SMILES | Cc1c(C)n(C)c(=O)n(-c2cc(S)c(Cl)cc2F)c1=O |
| InChI | InChI=1S/C13H12ClFN2O2S/c1-6-7(2)16(3)13(19)17(12(6)18)10-5-11(20)8(14)4-9(10)15/h4-5,20H,1-3H3 |
| InChIKey | XSJIWJLWXNMXTE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|