C20H27N11O2 — CID 163706120
3-[2-[[5-[[5-[(5-amino-4-methyl-1,2,4-triazol-3-yl)amino]-1H-pyrrol-2-yl]methyl-methylamino]-4-methyl-1,2,4-triazol-3-yl]amino]ethyl]benzene-1,2-diol (PubChem CID 163706120) has the molecular formula C20H27N11O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is 3-[2-[[5-[[5-[(5-amino-4-methyl-1,2,4-triazol-3-yl)amino]-1H-pyrrol-2-yl]methyl-methylamino]-4-methyl-1,2,4-triazol-3-yl]amino]ethyl]benzene-1,2-diol.
| Compound Name | 3-[2-[[5-[[5-[(5-amino-4-methyl-1,2,4-triazol-3-yl)amino]-1H-pyrrol-2-yl]methyl-methylamino]-4-methyl-1,2,4-triazol-3-yl]amino]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 163706120 |
| Molecular Formula | C20H27N11O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-[2-[[5-[[5-[(5-amino-4-methyl-1,2,4-triazol-3-yl)amino]-1H-pyrrol-2-yl]methyl-methylamino]-4-methyl-1,2,4-triazol-3-yl]amino]ethyl]benzene-1,2-diol |
| SMILES | CN(Cc1ccc(Nc2nnc(N)n2C)[nH]1)c1nnc(NCCc2cccc(O)c2O)n1C |
| InChI | InChI=1S/C20H27N11O2/c1-29(11-13-7-8-15(23-13)24-19-27-25-17(21)30(19)2)20-28-26-18(31(20)3)22-10-9-12-5-4-6-14(32)16(12)33/h4-8,23,32-33H,9-11H2,1-3H3,(H2,21,25)(H,22,26)(H,24,27) |
| InChIKey | KFFSWHVMLNYMTB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 170.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|