C11H8O2 — CID 163706277
(1R)-5-methylidene-3-oxatricyclo[5.4.0.02,11]undeca-2(11),7,9-trien-6-one (PubChem CID 163706277) has the molecular formula C11H8O2 and a molecular weight of 172.18 g/mol. Its IUPAC name is (1R)-5-methylidene-3-oxatricyclo[5.4.0.02,11]undeca-2(11),7,9-trien-6-one.
| Compound Name | (1R)-5-methylidene-3-oxatricyclo[5.4.0.02,11]undeca-2(11),7,9-trien-6-one |
|---|---|
| PubChem CID | 163706277 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (1R)-5-methylidene-3-oxatricyclo[5.4.0.02,11]undeca-2(11),7,9-trien-6-one |
| SMILES | C=C1COC2=C3C=CC=C(C1=O)[C@@H]32 |
| InChI | InChI=1S/C11H8O2/c1-6-5-13-11-8-4-2-3-7(9(8)11)10(6)12/h2-4,9H,1,5H2/t9-/m0/s1 |
| InChIKey | KFIQGDOAAUVVPC-VIFPVBQESA-N |
| XLogP | 1.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|