C8H10F2INO — CID 163706438
[(2S)-4-[difluoro(iodo)methyl]-5-methyl-1,2-dihydropyridin-2-yl]methanol (PubChem CID 163706438) has the molecular formula C8H10F2INO and a molecular weight of 301.07 g/mol. Its IUPAC name is [(2S)-4-[difluoro(iodo)methyl]-5-methyl-1,2-dihydropyridin-2-yl]methanol.
| Compound Name | [(2S)-4-[difluoro(iodo)methyl]-5-methyl-1,2-dihydropyridin-2-yl]methanol |
|---|---|
| PubChem CID | 163706438 |
| Molecular Formula | C8H10F2INO |
| Molecular Weight | 301.07 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | [(2S)-4-[difluoro(iodo)methyl]-5-methyl-1,2-dihydropyridin-2-yl]methanol |
| SMILES | CC1=CN[C@H](CO)C=C1C(F)(F)I |
| InChI | InChI=1S/C8H10F2INO/c1-5-3-12-6(4-13)2-7(5)8(9,10)11/h2-3,6,12-13H,4H2,1H3/t6-/m0/s1 |
| InChIKey | KFLPEVGGDNVXJH-LURJTMIESA-N |
| XLogP | 1.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|