C27H37BO2 — CID 163706632
4,4,5,5-tetramethyl-2-[4-(10-methyl-1,2,8a,9,9a,10a-hexahydroanthracen-9-yl)cyclohex-3-en-1-yl]-1,3,2-dioxaborolane (PubChem CID 163706632) has the molecular formula C27H37BO2 and a molecular weight of 404.40 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(10-methyl-1,2,8a,9,9a,10a-hexahydroanthracen-9-yl)cyclohex-3-en-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(10-methyl-1,2,8a,9,9a,10a-hexahydroanthracen-9-yl)cyclohex-3-en-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163706632 |
| Molecular Formula | C27H37BO2 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(10-methyl-1,2,8a,9,9a,10a-hexahydroanthracen-9-yl)cyclohex-3-en-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC1=C2C=CCCC2C(C2=CCC(B3OC(C)(C)C(C)(C)O3)CC2)C2C=CC=CC12 |
| InChI | InChI=1S/C27H37BO2/c1-18-21-10-6-8-12-23(21)25(24-13-9-7-11-22(18)24)19-14-16-20(17-15-19)28-29-26(2,3)27(4,5)30-28/h6-8,10-12,14,20-21,23-25H,9,13,15-17H2,1-5H3 |
| InChIKey | KFPZFDLBHOIQHA-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|