C43H34N6 — CID 163706708
5-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)-1H-pyrrol-2-yl]-7-phenylindolo[2,3-b]carbazole (PubChem CID 163706708) has the molecular formula C43H34N6 and a molecular weight of 634.79 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)-1H-pyrrol-2-yl]-7-phenylindolo[2,3-b]carbazole.
| Compound Name | 5-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)-1H-pyrrol-2-yl]-7-phenylindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 163706708 |
| Molecular Formula | C43H34N6 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | 5-[4-(4,6-diphenyl-1,3,5-triazinan-2-yl)-1H-pyrrol-2-yl]-7-phenylindolo[2,3-b]carbazole |
| SMILES | c1ccc(C2NC(c3ccccc3)NC(c3c[nH]c(-n4c5ccccc5c5cc6c7ccccc7n(-c7ccccc7)c6cc54)c3)N2)cc1 |
| InChI | InChI=1S/C43H34N6/c1-4-14-28(15-5-1)41-45-42(29-16-6-2-7-17-29)47-43(46-41)30-24-40(44-27-30)49-37-23-13-11-21-33(37)35-25-34-32-20-10-12-22-36(32)48(38(34)26-39(35)49)31-18-8-3-9-19-31/h1-27,41-47H |
| InChIKey | XTOLTWIOASLZDF-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 61.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |