About methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide
methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide (PubChem CID 163707204) has the molecular formula C7H5F3NOs-
and a molecular weight of 350.35 g/mol. Its IUPAC name is methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide.
Molecular Properties
| Compound Name | methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide |
| PubChem CID | 163707204 |
| Molecular Formula | C7H5F3NOs- |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide |
| SMILES | C=[Os].FC(F)(F)c1cc[c-]nc1 |
| InChI | InChI=1S/C6H3F3N.CH2.Os/c7-6(8,9)5-2-1-3-10-4-5;;/h1-2,4H;1H2;/q-1;; |
| InChIKey | QYFUBERIDZWSEU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide?
The IUPAC name of methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide (CID 163707204) is methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide.
What is the SMILES notation for methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide?
The canonical SMILES for methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide is C=[Os].FC(F)(F)c1cc[c-]nc1.
What is the InChIKey of methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide?
The InChIKey is QYFUBERIDZWSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N.CH2.Os/c7-6(8,9)5-2-1-3-10-4-5;;/h1-2,4H;1H2;/q-1;;.
What are the key properties of methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide?
methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide has a molecular weight of 350.35 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylideneosmium;5-(trifluoromethyl)-2H-pyridin-2-ide is sourced from PubChem (CID 163707204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).