About CID 163707989
CID 163707989 (PubChem CID 163707989) has the molecular formula C12H12Cl2IN2-
and a molecular weight of 382.05 g/mol.
Molecular Properties
| Compound Name | CID 163707989 |
| PubChem CID | 163707989 |
| Molecular Formula | C12H12Cl2IN2- |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | — |
| SMILES | NCC1NCCC2=C1[I-]c1ccc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C12H12Cl2IN2/c13-7-1-2-8-10(11(7)14)6-3-4-17-9(5-16)12(6)15-8/h1-2,9,17H,3-5,16H2/q-1 |
| InChIKey | WYGAXVYZYWZRHW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163707989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163707989?
The IUPAC name of CID 163707989 (CID 163707989) is not available.
What is the SMILES notation for CID 163707989?
The canonical SMILES for CID 163707989 is NCC1NCCC2=C1[I-]c1ccc(Cl)c(Cl)c12.
What is the InChIKey of CID 163707989?
The InChIKey is WYGAXVYZYWZRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2IN2/c13-7-1-2-8-10(11(7)14)6-3-4-17-9(5-16)12(6)15-8/h1-2,9,17H,3-5,16H2/q-1.
What are the key properties of CID 163707989?
CID 163707989 has a molecular weight of 382.05 g/mol, XLogP of -0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163707989 is sourced from PubChem (CID 163707989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).