C13H22O2 — CID 163708833
3-butyl-1-methoxy-1,3,3a,4,5,6-hexahydro-2-benzofuran (PubChem CID 163708833) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-butyl-1-methoxy-1,3,3a,4,5,6-hexahydro-2-benzofuran.
| Compound Name | 3-butyl-1-methoxy-1,3,3a,4,5,6-hexahydro-2-benzofuran |
|---|---|
| PubChem CID | 163708833 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-butyl-1-methoxy-1,3,3a,4,5,6-hexahydro-2-benzofuran |
| SMILES | CCCCC1OC(OC)C2=CCCCC21 |
| InChI | InChI=1S/C13H22O2/c1-3-4-9-12-10-7-5-6-8-11(10)13(14-2)15-12/h8,10,12-13H,3-7,9H2,1-2H3 |
| InChIKey | KHKNBDVNVKYDJB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|