About 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole
3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole (PubChem CID 163708868) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole |
| PubChem CID | 163708868 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole |
| SMILES | CC1CCC1C1C#CNC1 |
| InChI | InChI=1S/C9H13N/c1-7-2-3-9(7)8-4-5-10-6-8/h7-10H,2-3,6H2,1H3 |
| InChIKey | KHLHMDWHVNYNEW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole?
The IUPAC name of 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole (CID 163708868) is 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole is CC1CCC1C1C#CNC1.
What is the InChIKey of 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole?
The InChIKey is KHLHMDWHVNYNEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-7-2-3-9(7)8-4-5-10-6-8/h7-10H,2-3,6H2,1H3.
What are the key properties of 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole?
3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole has a molecular weight of 135.21 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylcyclobutyl)-4,5-didehydro-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 163708868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).