C38H26O11 — CID 163708943
6-[8-[10-(2,3,4,5,6-pentahydroxycyclohexa-1,5-dien-1-yl)anthracen-9-yl]dibenzofuran-3-yl]benzene-1,2,3,4,5-pentol (PubChem CID 163708943) has the molecular formula C38H26O11 and a molecular weight of 658.62 g/mol. Its IUPAC name is 6-[8-[10-(2,3,4,5,6-pentahydroxycyclohexa-1,5-dien-1-yl)anthracen-9-yl]dibenzofuran-3-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[8-[10-(2,3,4,5,6-pentahydroxycyclohexa-1,5-dien-1-yl)anthracen-9-yl]dibenzofuran-3-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 163708943 |
| Molecular Formula | C38H26O11 |
| Molecular Weight | 658.62 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | 6-[8-[10-(2,3,4,5,6-pentahydroxycyclohexa-1,5-dien-1-yl)anthracen-9-yl]dibenzofuran-3-yl]benzene-1,2,3,4,5-pentol |
| SMILES | OC1=C(O)C(O)C(O)C(O)=C1c1c2ccccc2c(-c2ccc3oc4cc(-c5c(O)c(O)c(O)c(O)c5O)ccc4c3c2)c2ccccc12 |
| InChI | InChI=1S/C38H26O11/c39-29-26(30(40)34(44)37(47)33(29)43)16-9-11-17-22-13-15(10-12-23(22)49-24(17)14-16)25-18-5-1-3-7-20(18)27(21-8-4-2-6-19(21)25)28-31(41)35(45)38(48)36(46)32(28)42/h1-14,35,38-48H |
| InChIKey | KHNCRUVMPUHPQS-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 215.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|