C13H24BNO2 — CID 163709122
[(2R,6R,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.2.2.02,7]dodecan-4-yl]methanamine (PubChem CID 163709122) has the molecular formula C13H24BNO2 and a molecular weight of 237.15 g/mol. Its IUPAC name is [(2R,6R,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.2.2.02,7]dodecan-4-yl]methanamine.
| Compound Name | [(2R,6R,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.2.2.02,7]dodecan-4-yl]methanamine |
|---|---|
| PubChem CID | 163709122 |
| Molecular Formula | C13H24BNO2 |
| Molecular Weight | 237.15 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | [(2R,6R,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.2.2.02,7]dodecan-4-yl]methanamine |
| SMILES | CC1OB(CN)O[C@@H]2C3CC[C@H](C12)C(C)(C)C3 |
| InChI | InChI=1S/C13H24BNO2/c1-8-11-10-5-4-9(6-13(10,2)3)12(11)17-14(7-15)16-8/h8-12H,4-7,15H2,1-3H3/t8?,9?,10-,11?,12-/m1/s1 |
| InChIKey | KHQYVZOXHAYYMV-NPLYTMANSA-N |
| XLogP | 1.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|